C15H18N2O3S — CID 8866526
N-[(Z)-2,3-dihydroinden-1-ylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 8866526) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydroinden-1-ylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | N-[(Z)-2,3-dihydroinden-1-ylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 8866526 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-[(Z)-2,3-dihydroinden-1-ylideneamino]-2-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCS(=O)(=O)C1)N/N=C1/CCc2ccccc21 |
| InChI | InChI=1S/C15H18N2O3S/c18-15(9-11-7-8-21(19,20)10-11)17-16-14-6-5-12-3-1-2-4-13(12)14/h1-4,11H,5-10H2,(H,17,18)/b16-14-/t11-/m0/s1 |
| InChIKey | GICJXZICOZYDIK-NLPIWRNCSA-N |
| XLogP | 1.28 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|