C16H16N3O+ — CID 6085414
N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-pyridin-1-ium-1-ylacetamide (PubChem CID 6085414) has the molecular formula C16H16N3O+ and a molecular weight of 266.32 g/mol. Its IUPAC name is N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-pyridin-1-ium-1-ylacetamide.
| Compound Name | N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-pyridin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 6085414 |
| Molecular Formula | C16H16N3O+ |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-pyridin-1-ium-1-ylacetamide |
| SMILES | O=C(C[n+]1ccccc1)N/N=C1\CCc2ccccc21 |
| InChI | InChI=1S/C16H15N3O/c20-16(12-19-10-4-1-5-11-19)18-17-15-9-8-13-6-2-3-7-14(13)15/h1-7,10-11H,8-9,12H2/p+1/b17-15+ |
| InChIKey | PDBPUIDTKNDHRY-BMRADRMJSA-O |
| XLogP | 1.44 |
| TPSA | 45.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|