C18H16N6O — CID 6153371
N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 6153371) has the molecular formula C18H16N6O and a molecular weight of 332.37 g/mol. Its IUPAC name is N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 6153371 |
| Molecular Formula | C18H16N6O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[(E)-2,3-dihydroinden-1-ylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)N/N=C1\CCc2ccccc21 |
| InChI | InChI=1S/C18H16N6O/c25-17(20-19-16-11-10-13-6-4-5-9-15(13)16)12-24-22-18(21-23-24)14-7-2-1-3-8-14/h1-9H,10-12H2,(H,20,25)/b19-16+ |
| InChIKey | OQTPSUVCLWPWOW-KNTRCKAVSA-N |
| XLogP | 1.81 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|