C15H20N6O — CID 8524115
N-[(Z)-[(3S)-3-methylpentan-2-ylidene]amino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 8524115) has the molecular formula C15H20N6O and a molecular weight of 300.37 g/mol. Its IUPAC name is N-[(Z)-[(3S)-3-methylpentan-2-ylidene]amino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(Z)-[(3S)-3-methylpentan-2-ylidene]amino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 8524115 |
| Molecular Formula | C15H20N6O |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-[(Z)-[(3S)-3-methylpentan-2-ylidene]amino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | CC[C@H](C)/C(C)=N\NC(=O)Cn1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H20N6O/c1-4-11(2)12(3)16-17-14(22)10-21-19-15(18-20-21)13-8-6-5-7-9-13/h5-9,11H,4,10H2,1-3H3,(H,17,22)/b16-12-/t11-/m0/s1 |
| InChIKey | LVWCYFDJODVMSC-SPSOFYIISA-N |
| XLogP | 1.88 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|