C18H18N6O2 — CID 135552028
N-[(E)-1-(2-hydroxy-5-methylphenyl)ethylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 135552028) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[(E)-1-(2-hydroxy-5-methylphenyl)ethylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(E)-1-(2-hydroxy-5-methylphenyl)ethylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 135552028 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-[(E)-1-(2-hydroxy-5-methylphenyl)ethylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | C/C(=N\NC(=O)Cn1nnc(-c2ccccc2)n1)c1cc(C)ccc1O |
| InChI | InChI=1S/C18H18N6O2/c1-12-8-9-16(25)15(10-12)13(2)19-20-17(26)11-24-22-18(21-23-24)14-6-4-3-5-7-14/h3-10,25H,11H2,1-2H3,(H,20,26)/b19-13+ |
| InChIKey | CEPYZYPLRFMWIE-CPNJWEJPSA-N |
| XLogP | 1.89 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|