C16H16N6O — CID 8524141
N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 8524141) has the molecular formula C16H16N6O and a molecular weight of 308.34 g/mol. Its IUPAC name is N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 8524141 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)N/N=C1/C[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C16H16N6O/c23-15(18-17-14-9-12-7-4-8-13(12)14)10-22-20-16(19-21-22)11-5-2-1-3-6-11/h1-7,12-13H,8-10H2,(H,18,23)/b17-14-/t12-,13-/m0/s1 |
| InChIKey | XCNQCCZLXFGZCO-ZFZJTJTISA-N |
| XLogP | 1.41 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|