C18H18N6O2 — CID 9391808
N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 9391808) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9391808 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | N-[(Z)-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | C[C@@H]1C[C@H]1c1ccc(/C=N\NC(=O)Cn2nnc(-c3ccccc3)n2)o1 |
| InChI | InChI=1S/C18H18N6O2/c1-12-9-15(12)16-8-7-14(26-16)10-19-20-17(25)11-24-22-18(21-23-24)13-5-3-2-4-6-13/h2-8,10,12,15H,9,11H2,1H3,(H,20,25)/b19-10-/t12-,15-/m1/s1 |
| InChIKey | YENIWPBWCIMXCO-WPMPYRKTSA-N |
| XLogP | 2.21 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|