C20H15ClN6O2 — CID 3886610
N-[[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 3886610) has the molecular formula C20H15ClN6O2 and a molecular weight of 406.83 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3886610 |
| Molecular Formula | C20H15ClN6O2 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[[5-(2-chlorophenyl)furan-2-yl]methylideneamino]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)NN=Cc1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C20H15ClN6O2/c21-17-9-5-4-8-16(17)18-11-10-15(29-18)12-22-23-19(28)13-27-25-20(24-26-27)14-6-2-1-3-7-14/h1-12H,13H2,(H,23,28) |
| InChIKey | LPLQGGITJNAPIS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|