C17H12Cl2N6O3 — CID 73253796
N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-[5-(2-chlorophenyl)tetrazol-2-yl]acetamide (PubChem CID 73253796) has the molecular formula C17H12Cl2N6O3 and a molecular weight of 419.23 g/mol. Its IUPAC name is N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-[5-(2-chlorophenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-[5-(2-chlorophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 73253796 |
| Molecular Formula | C17H12Cl2N6O3 |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-[5-(2-chlorophenyl)tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2Cl)n1)N/N=C/c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C17H12Cl2N6O3/c18-12-4-2-1-3-11(12)17-22-24-25(23-17)8-16(26)21-20-7-10-5-14-15(6-13(10)19)28-9-27-14/h1-7H,8-9H2,(H,21,26)/b20-7+ |
| InChIKey | BUTICEOUQURCIM-IFRROFPPSA-N |
| XLogP | 2.53 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|