C19H20FN3O3 — CID 135735292
N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2-(2-methoxyanilino)acetamide (PubChem CID 135735292) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2-(2-methoxyanilino)acetamide.
| Compound Name | N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2-(2-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 135735292 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2-(2-methoxyanilino)acetamide |
| SMILES | COc1ccccc1NCC(=O)N/N=C1\C[C@H](C)c2c(F)ccc(O)c21 |
| InChI | InChI=1S/C19H20FN3O3/c1-11-9-14(19-15(24)8-7-12(20)18(11)19)22-23-17(25)10-21-13-5-3-4-6-16(13)26-2/h3-8,11,21,24H,9-10H2,1-2H3,(H,23,25)/b22-14+/t11-/m0/s1 |
| InChIKey | PZBWYBVRDXERDH-MAMUZICDSA-N |
| XLogP | 2.98 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|