C17H17FN2O3 — CID 135836861
N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2,5-dimethylfuran-3-carboxamide (PubChem CID 135836861) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 135836861 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C2\C[C@H](C)c3c(F)ccc(O)c32)c(C)o1 |
| InChI | InChI=1S/C17H17FN2O3/c1-8-6-13(16-14(21)5-4-12(18)15(8)16)19-20-17(22)11-7-9(2)23-10(11)3/h4-5,7-8,21H,6H2,1-3H3,(H,20,22)/b19-13+/t8-/m0/s1 |
| InChIKey | DFGYVNICWURWBA-DOSSUMKYSA-N |
| XLogP | 3.38 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|