C17H14F2N2O2 — CID 135836849
2-fluoro-N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]benzamide (PubChem CID 135836849) has the molecular formula C17H14F2N2O2 and a molecular weight of 316.31 g/mol. Its IUPAC name is 2-fluoro-N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]benzamide.
| Compound Name | 2-fluoro-N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 135836849 |
| Molecular Formula | C17H14F2N2O2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-fluoro-N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]benzamide |
| SMILES | C[C@@H]1C/C(=N\NC(=O)c2ccccc2F)c2c(O)ccc(F)c21 |
| InChI | InChI=1S/C17H14F2N2O2/c1-9-8-13(16-14(22)7-6-12(19)15(9)16)20-21-17(23)10-4-2-3-5-11(10)18/h2-7,9,22H,8H2,1H3,(H,21,23)/b20-13+/t9-/m1/s1 |
| InChIKey | SDTFVHJTTVRHSZ-FLNUOUKISA-N |
| XLogP | 3.31 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|