C15H12Cl2FN3O — CID 135836986
(1R,3E)-3-[(3,5-dichloro-2-pyridinyl)hydrazinylidene]-7-fluoro-1-methyl-1,2-dihydroinden-4-ol (PubChem CID 135836986) has the molecular formula C15H12Cl2FN3O and a molecular weight of 340.19 g/mol. Its IUPAC name is (1R,3E)-3-[(3,5-dichloro-2-pyridinyl)hydrazinylidene]-7-fluoro-1-methyl-1,2-dihydroinden-4-ol.
| Compound Name | (1R,3E)-3-[(3,5-dichloro-2-pyridinyl)hydrazinylidene]-7-fluoro-1-methyl-1,2-dihydroinden-4-ol |
|---|---|
| PubChem CID | 135836986 |
| Molecular Formula | C15H12Cl2FN3O |
| Molecular Weight | 340.19 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (1R,3E)-3-[(3,5-dichloro-2-pyridinyl)hydrazinylidene]-7-fluoro-1-methyl-1,2-dihydroinden-4-ol |
| SMILES | C[C@@H]1C/C(=N\Nc2ncc(Cl)cc2Cl)c2c(O)ccc(F)c21 |
| InChI | InChI=1S/C15H12Cl2FN3O/c1-7-4-11(14-12(22)3-2-10(18)13(7)14)20-21-15-9(17)5-8(16)6-19-15/h2-3,5-7,22H,4H2,1H3,(H,19,21)/b20-11+/t7-/m1/s1 |
| InChIKey | UIWJJFMFXBVNBK-GISYMBHFSA-N |
| XLogP | 4.56 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.19 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|