C18H15FN2O4 — CID 135836843
N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-1,3-benzodioxole-5-carboxamide (PubChem CID 135836843) has the molecular formula C18H15FN2O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 135836843 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[(E)-[(3R)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-1,3-benzodioxole-5-carboxamide |
| SMILES | C[C@@H]1C/C(=N\NC(=O)c2ccc3c(c2)OCO3)c2c(O)ccc(F)c21 |
| InChI | InChI=1S/C18H15FN2O4/c1-9-6-12(17-13(22)4-3-11(19)16(9)17)20-21-18(23)10-2-5-14-15(7-10)25-8-24-14/h2-5,7,9,22H,6,8H2,1H3,(H,21,23)/b20-12+/t9-/m1/s1 |
| InChIKey | ZJIHNCZPCZBPAS-OXBFRWJMSA-N |
| XLogP | 2.90 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|