C17H13FN2O5S — CID 4845190
N-[(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]-1,3-benzodioxole-5-carboxamide (PubChem CID 4845190) has the molecular formula C17H13FN2O5S and a molecular weight of 376.37 g/mol. Its IUPAC name is N-[(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4845190 |
| Molecular Formula | C17H13FN2O5S |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | N-[(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NN=C1CCS(=O)(=O)c2ccc(F)cc21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H13FN2O5S/c18-11-2-4-16-12(8-11)13(5-6-26(16,22)23)19-20-17(21)10-1-3-14-15(7-10)25-9-24-14/h1-4,7-8H,5-6,9H2,(H,20,21) |
| InChIKey | VNMUNSSUMWKSAU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|