C17H13FN2O3S — CID 2663550
N'-(6-fluoro-2H-thiochromen-4-yl)-1,3-benzodioxole-5-carbohydrazide (PubChem CID 2663550) has the molecular formula C17H13FN2O3S and a molecular weight of 344.37 g/mol. Its IUPAC name is N'-(6-fluoro-2H-thiochromen-4-yl)-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-(6-fluoro-2H-thiochromen-4-yl)-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 2663550 |
| Molecular Formula | C17H13FN2O3S |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N'-(6-fluoro-2H-thiochromen-4-yl)-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(NNC1=CCSc2ccc(F)cc21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H13FN2O3S/c18-11-2-4-16-12(8-11)13(5-6-24-16)19-20-17(21)10-1-3-14-15(7-10)23-9-22-14/h1-5,7-8,19H,6,9H2,(H,20,21) |
| InChIKey | LIZPFCIAXQFCFH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|