C12H12N2O3S — CID 2368011
N'-(2,3-dihydrothiophen-4-yl)-1,3-benzodioxole-5-carbohydrazide (PubChem CID 2368011) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is N'-(2,3-dihydrothiophen-4-yl)-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-(2,3-dihydrothiophen-4-yl)-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 2368011 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | N'-(2,3-dihydrothiophen-4-yl)-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(NNC1=CSCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H12N2O3S/c15-12(14-13-9-3-4-18-6-9)8-1-2-10-11(5-8)17-7-16-10/h1-2,5-6,13H,3-4,7H2,(H,14,15) |
| InChIKey | KQCOBNLAHLLYSI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|