C13H10N6O3 — CID 4702675
N'-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3-benzodioxole-5-carbohydrazide (PubChem CID 4702675) has the molecular formula C13H10N6O3 and a molecular weight of 298.26 g/mol. Its IUPAC name is N'-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 4702675 |
| Molecular Formula | C13H10N6O3 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N'-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(NNc1ccc2nncn2n1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H10N6O3/c20-13(8-1-2-9-10(5-8)22-7-21-9)17-15-11-3-4-12-16-14-6-19(12)18-11/h1-6H,7H2,(H,15,18)(H,17,20) |
| InChIKey | ZWCFRRSWMRFQHK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|