C9H9Cl2N3S — CID 16556187
3,5-dichloro-N-[(E)-thiolan-3-ylideneamino]pyridin-2-amine (PubChem CID 16556187) has the molecular formula C9H9Cl2N3S and a molecular weight of 262.16 g/mol. Its IUPAC name is 3,5-dichloro-N-[(E)-thiolan-3-ylideneamino]pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[(E)-thiolan-3-ylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 16556187 |
| Molecular Formula | C9H9Cl2N3S |
| Molecular Weight | 262.16 g/mol |
| Exact Mass | 260.99 |
| IUPAC Name | 3,5-dichloro-N-[(E)-thiolan-3-ylideneamino]pyridin-2-amine |
| SMILES | Clc1cnc(N/N=C2\CCSC2)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2N3S/c10-6-3-8(11)9(12-4-6)14-13-7-1-2-15-5-7/h3-4H,1-2,5H2,(H,12,14)/b13-7+ |
| InChIKey | SDUWJQYQHAFJGE-NTUHNPAUSA-N |
| XLogP | 3.29 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|