C17H16FN3OS2 — CID 8900225
1-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-3-(3-methoxyphenyl)thiourea (PubChem CID 8900225) has the molecular formula C17H16FN3OS2 and a molecular weight of 361.47 g/mol. Its IUPAC name is 1-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8900225 |
| Molecular Formula | C17H16FN3OS2 |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-[(6-fluoro-2,3-dihydrothiochromen-4-ylidene)amino]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)NN=C2CCSc3ccc(F)cc32)c1 |
| InChI | InChI=1S/C17H16FN3OS2/c1-22-13-4-2-3-12(10-13)19-17(23)21-20-15-7-8-24-16-6-5-11(18)9-14(15)16/h2-6,9-10H,7-8H2,1H3,(H2,19,21,23) |
| InChIKey | REPMEEIEOOPJNW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|