C13H14BrNO2S — CID 171316368
N-(7-bromospiro[3H-chromene-2,4'-thiane]-4-ylidene)hydroxylamine (PubChem CID 171316368) has the molecular formula C13H14BrNO2S and a molecular weight of 328.23 g/mol. Its IUPAC name is N-(7-bromospiro[3H-chromene-2,4'-thiane]-4-ylidene)hydroxylamine.
| Compound Name | N-(7-bromospiro[3H-chromene-2,4'-thiane]-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 171316368 |
| Molecular Formula | C13H14BrNO2S |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | N-(7-bromospiro[3H-chromene-2,4'-thiane]-4-ylidene)hydroxylamine |
| SMILES | ON=C1CC2(CCSCC2)Oc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H14BrNO2S/c14-9-1-2-10-11(15-16)8-13(17-12(10)7-9)3-5-18-6-4-13/h1-2,7,16H,3-6,8H2 |
| InChIKey | SIIQZWAVEBWQFB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|