C18H24BrNO3S — CID 87380325
(NE)-N-(6-bromospiro[3H-chromene-2,1'-cyclohexane]-4-ylidene)-2-methylpropane-2-sulfonamide (PubChem CID 87380325) has the molecular formula C18H24BrNO3S and a molecular weight of 414.37 g/mol. Its IUPAC name is (NE)-N-(6-bromospiro[3H-chromene-2,1'-cyclohexane]-4-ylidene)-2-methylpropane-2-sulfonamide.
| Compound Name | (NE)-N-(6-bromospiro[3H-chromene-2,1'-cyclohexane]-4-ylidene)-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 87380325 |
| Molecular Formula | C18H24BrNO3S |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | (NE)-N-(6-bromospiro[3H-chromene-2,1'-cyclohexane]-4-ylidene)-2-methylpropane-2-sulfonamide |
| SMILES | CC(C)(C)S(=O)(=O)/N=C1\CC2(CCCCC2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C18H24BrNO3S/c1-17(2,3)24(21,22)20-15-12-18(9-5-4-6-10-18)23-16-8-7-13(19)11-14(15)16/h7-8,11H,4-6,9-10,12H2,1-3H3/b20-15+ |
| InChIKey | GJVUEPCIHGVCGI-HMMYKYKNSA-N |
| XLogP | 4.85 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|