C20H17BrN2O — CID 123218744
(E)-6-bromo-N-isocyanospiro[3H-chromene-2,6'-5,7,8,9-tetrahydrobenzo[7]annulene]-4-imine (PubChem CID 123218744) has the molecular formula C20H17BrN2O and a molecular weight of 381.27 g/mol. Its IUPAC name is (E)-6-bromo-N-isocyanospiro[3H-chromene-2,6'-5,7,8,9-tetrahydrobenzo[7]annulene]-4-imine.
| Compound Name | (E)-6-bromo-N-isocyanospiro[3H-chromene-2,6'-5,7,8,9-tetrahydrobenzo[7]annulene]-4-imine |
|---|---|
| PubChem CID | 123218744 |
| Molecular Formula | C20H17BrN2O |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (E)-6-bromo-N-isocyanospiro[3H-chromene-2,6'-5,7,8,9-tetrahydrobenzo[7]annulene]-4-imine |
| SMILES | [C-]#[N+]/N=C1\CC2(CCCc3ccccc3C2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C20H17BrN2O/c1-22-23-18-13-20(24-19-9-8-16(21)11-17(18)19)10-4-7-14-5-2-3-6-15(14)12-20/h2-3,5-6,8-9,11H,4,7,10,12-13H2/b23-18+ |
| InChIKey | OWBGOFGCUJBIKM-PTGBLXJZSA-N |
| XLogP | 5.17 |
| TPSA | 25.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|