C15H20O — CID 86182652
spiro[2,5-dihydro-1H-3-benzoxepine-4,1'-cyclohexane] (PubChem CID 86182652) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is spiro[2,5-dihydro-1H-3-benzoxepine-4,1'-cyclohexane].
| Compound Name | spiro[2,5-dihydro-1H-3-benzoxepine-4,1'-cyclohexane] |
|---|---|
| PubChem CID | 86182652 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | spiro[2,5-dihydro-1H-3-benzoxepine-4,1'-cyclohexane] |
| SMILES | c1ccc2c(c1)CCOC1(CCCCC1)C2 |
| InChI | InChI=1S/C15H20O/c1-4-9-15(10-5-1)12-14-7-3-2-6-13(14)8-11-16-15/h2-3,6-7H,1,4-5,8-12H2 |
| InChIKey | GLIHMLDAGVPISE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |