C19H27NO — CID 79907765
1-(1-oxaspiro[5.5]undecan-4-yl)-2,3-dihydroinden-1-amine (PubChem CID 79907765) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-(1-oxaspiro[5.5]undecan-4-yl)-2,3-dihydroinden-1-amine.
| Compound Name | 1-(1-oxaspiro[5.5]undecan-4-yl)-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 79907765 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-(1-oxaspiro[5.5]undecan-4-yl)-2,3-dihydroinden-1-amine |
| SMILES | NC1(C2CCOC3(CCCCC3)C2)CCc2ccccc21 |
| InChI | InChI=1S/C19H27NO/c20-19(12-8-15-6-2-3-7-17(15)19)16-9-13-21-18(14-16)10-4-1-5-11-18/h2-3,6-7,16H,1,4-5,8-14,20H2 |
| InChIKey | KXDRDKZTVDIQSI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |