C19H26O2 — CID 79899726
1-(6-oxaspiro[4.5]decan-9-yl)-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 79899726) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is 1-(6-oxaspiro[4.5]decan-9-yl)-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | 1-(6-oxaspiro[4.5]decan-9-yl)-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 79899726 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1-(6-oxaspiro[4.5]decan-9-yl)-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | OC1(C2CCOC3(CCCC3)C2)CCCc2ccccc21 |
| InChI | InChI=1S/C19H26O2/c20-19(12-5-7-15-6-1-2-8-17(15)19)16-9-13-21-18(14-16)10-3-4-11-18/h1-2,6,8,16,20H,3-5,7,9-14H2 |
| InChIKey | DAZMMCCYBGGBRD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |