C17H23NO3 — CID 80562702
5-amino-1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,3-dihydroinden-1-ol (PubChem CID 80562702) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 5-amino-1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,3-dihydroinden-1-ol.
| Compound Name | 5-amino-1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 80562702 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 5-amino-1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,3-dihydroinden-1-ol |
| SMILES | Nc1ccc2c(c1)CCC2(O)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C17H23NO3/c18-14-1-2-15-12(9-14)3-5-17(15,19)13-4-7-21-16(10-13)6-8-20-11-16/h1-2,9,13,19H,3-8,10-11,18H2 |
| InChIKey | BSOPPMOOWKCQIS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|