C14H18ClNO3S — CID 81201989
4-chloro-3-(2,6-dioxaspiro[4.5]decan-9-ylsulfinyl)aniline (PubChem CID 81201989) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is 4-chloro-3-(2,6-dioxaspiro[4.5]decan-9-ylsulfinyl)aniline.
| Compound Name | 4-chloro-3-(2,6-dioxaspiro[4.5]decan-9-ylsulfinyl)aniline |
|---|---|
| PubChem CID | 81201989 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-chloro-3-(2,6-dioxaspiro[4.5]decan-9-ylsulfinyl)aniline |
| SMILES | Nc1ccc(Cl)c(S(=O)C2CCOC3(CCOC3)C2)c1 |
| InChI | InChI=1S/C14H18ClNO3S/c15-12-2-1-10(16)7-13(12)20(17)11-3-5-19-14(8-11)4-6-18-9-14/h1-2,7,11H,3-6,8-9,16H2 |
| InChIKey | LXWDRUOISICHTB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|