C14H18FNO3S — CID 81183255
2-(2,6-dioxaspiro[4.5]decan-9-ylsulfinyl)-4-fluoroaniline (PubChem CID 81183255) has the molecular formula C14H18FNO3S and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(2,6-dioxaspiro[4.5]decan-9-ylsulfinyl)-4-fluoroaniline.
| Compound Name | 2-(2,6-dioxaspiro[4.5]decan-9-ylsulfinyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 81183255 |
| Molecular Formula | C14H18FNO3S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-(2,6-dioxaspiro[4.5]decan-9-ylsulfinyl)-4-fluoroaniline |
| SMILES | Nc1ccc(F)cc1S(=O)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C14H18FNO3S/c15-10-1-2-12(16)13(7-10)20(17)11-3-5-19-14(8-11)4-6-18-9-14/h1-2,7,11H,3-6,8-9,16H2 |
| InChIKey | MQDLXVPVJOSZCT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|