C15H18F3NO2 — CID 105017180
2,6-dioxaspiro[4.5]decan-9-yl-(2,4,6-trifluorophenyl)methanamine (PubChem CID 105017180) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is 2,6-dioxaspiro[4.5]decan-9-yl-(2,4,6-trifluorophenyl)methanamine.
| Compound Name | 2,6-dioxaspiro[4.5]decan-9-yl-(2,4,6-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 105017180 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2,6-dioxaspiro[4.5]decan-9-yl-(2,4,6-trifluorophenyl)methanamine |
| SMILES | NC(c1c(F)cc(F)cc1F)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C15H18F3NO2/c16-10-5-11(17)13(12(18)6-10)14(19)9-1-3-21-15(7-9)2-4-20-8-15/h5-6,9,14H,1-4,7-8,19H2 |
| InChIKey | OUOOGIDDXDXXSZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |