C15H20FNO3S — CID 81192876
2-(1,9-dioxaspiro[5.5]undecan-4-ylsulfinyl)-4-fluoroaniline (PubChem CID 81192876) has the molecular formula C15H20FNO3S and a molecular weight of 313.39 g/mol. Its IUPAC name is 2-(1,9-dioxaspiro[5.5]undecan-4-ylsulfinyl)-4-fluoroaniline.
| Compound Name | 2-(1,9-dioxaspiro[5.5]undecan-4-ylsulfinyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 81192876 |
| Molecular Formula | C15H20FNO3S |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-(1,9-dioxaspiro[5.5]undecan-4-ylsulfinyl)-4-fluoroaniline |
| SMILES | Nc1ccc(F)cc1S(=O)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H20FNO3S/c16-11-1-2-13(17)14(9-11)21(18)12-3-6-20-15(10-12)4-7-19-8-5-15/h1-2,9,12H,3-8,10,17H2 |
| InChIKey | BPTRRUZIWHSHNZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|