C14H19NO2S2 — CID 81180805
3-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfinyl)aniline (PubChem CID 81180805) has the molecular formula C14H19NO2S2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 3-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfinyl)aniline.
| Compound Name | 3-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfinyl)aniline |
|---|---|
| PubChem CID | 81180805 |
| Molecular Formula | C14H19NO2S2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfinyl)aniline |
| SMILES | Nc1cccc(S(=O)C2CCOC3(CCSC3)C2)c1 |
| InChI | InChI=1S/C14H19NO2S2/c15-11-2-1-3-12(8-11)19(16)13-4-6-17-14(9-13)5-7-18-10-14/h1-3,8,13H,4-7,9-10,15H2 |
| InChIKey | GEWCCKGZZDNPLW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|