C13H18N2O2S2 — CID 79911392
2-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfinyl)pyridin-3-amine (PubChem CID 79911392) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfinyl)pyridin-3-amine.
| Compound Name | 2-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfinyl)pyridin-3-amine |
|---|---|
| PubChem CID | 79911392 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-(6-oxa-2-thiaspiro[4.5]decan-9-ylsulfinyl)pyridin-3-amine |
| SMILES | Nc1cccnc1S(=O)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C13H18N2O2S2/c14-11-2-1-5-15-12(11)19(16)10-3-6-17-13(8-10)4-7-18-9-13/h1-2,5,10H,3-4,6-9,14H2 |
| InChIKey | PXIKKHOCYXPPOH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |