C9H12N2O3S2 — CID 61367917
2-(1,1-dioxothiolan-3-yl)sulfinylpyridin-3-amine (PubChem CID 61367917) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)sulfinylpyridin-3-amine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)sulfinylpyridin-3-amine |
|---|---|
| PubChem CID | 61367917 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)sulfinylpyridin-3-amine |
| SMILES | Nc1cccnc1S(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H12N2O3S2/c10-8-2-1-4-11-9(8)15(12)7-3-5-16(13,14)6-7/h1-2,4,7H,3,5-6,10H2 |
| InChIKey | HXANFZJWJPXMSH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |