C9H10O6S2 — CID 63947392
5-(1,1-dioxothiolan-3-yl)sulfinylfuran-2-carboxylic acid (PubChem CID 63947392) has the molecular formula C9H10O6S2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-(1,1-dioxothiolan-3-yl)sulfinylfuran-2-carboxylic acid.
| Compound Name | 5-(1,1-dioxothiolan-3-yl)sulfinylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 63947392 |
| Molecular Formula | C9H10O6S2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 5-(1,1-dioxothiolan-3-yl)sulfinylfuran-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)C2CCS(=O)(=O)C2)o1 |
| InChI | InChI=1S/C9H10O6S2/c10-9(11)7-1-2-8(15-7)16(12)6-3-4-17(13,14)5-6/h1-2,6H,3-5H2,(H,10,11) |
| InChIKey | ALHLUEQATNWHOP-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |