C10H12ClNO3S2 — CID 81182039
3-chloro-4-(1,1-dioxothiolan-3-yl)sulfinylaniline (PubChem CID 81182039) has the molecular formula C10H12ClNO3S2 and a molecular weight of 293.80 g/mol. Its IUPAC name is 3-chloro-4-(1,1-dioxothiolan-3-yl)sulfinylaniline.
| Compound Name | 3-chloro-4-(1,1-dioxothiolan-3-yl)sulfinylaniline |
|---|---|
| PubChem CID | 81182039 |
| Molecular Formula | C10H12ClNO3S2 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 3-chloro-4-(1,1-dioxothiolan-3-yl)sulfinylaniline |
| SMILES | Nc1ccc(S(=O)C2CCS(=O)(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO3S2/c11-9-5-7(12)1-2-10(9)16(13)8-3-4-17(14,15)6-8/h1-2,5,8H,3-4,6,12H2 |
| InChIKey | GLLLRXGAEIGCLB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|