C10H11FO3S2 — CID 64715422
3-(2-fluorophenyl)sulfinylthiolane 1,1-dioxide (PubChem CID 64715422) has the molecular formula C10H11FO3S2 and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-(2-fluorophenyl)sulfinylthiolane 1,1-dioxide.
| Compound Name | 3-(2-fluorophenyl)sulfinylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 64715422 |
| Molecular Formula | C10H11FO3S2 |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 3-(2-fluorophenyl)sulfinylthiolane 1,1-dioxide |
| SMILES | O=S(c1ccccc1F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H11FO3S2/c11-9-3-1-2-4-10(9)15(12)8-5-6-16(13,14)7-8/h1-4,8H,5-7H2 |
| InChIKey | HRQKCOCGSZLVMS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |