C13H18FNOS — CID 79581435
2-[2-(2-fluorophenyl)sulfinylethyl]cyclopentan-1-amine (PubChem CID 79581435) has the molecular formula C13H18FNOS and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-[2-(2-fluorophenyl)sulfinylethyl]cyclopentan-1-amine.
| Compound Name | 2-[2-(2-fluorophenyl)sulfinylethyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 79581435 |
| Molecular Formula | C13H18FNOS |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-[2-(2-fluorophenyl)sulfinylethyl]cyclopentan-1-amine |
| SMILES | NC1CCCC1CCS(=O)c1ccccc1F |
| InChI | InChI=1S/C13H18FNOS/c14-11-5-1-2-7-13(11)17(16)9-8-10-4-3-6-12(10)15/h1-2,5,7,10,12H,3-4,6,8-9,15H2 |
| InChIKey | CKYPPQIKKMEYQK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |