C11H14Cl2N2O4S2 — CID 43648502
4-amino-2,6-dichloro-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide (PubChem CID 43648502) has the molecular formula C11H14Cl2N2O4S2 and a molecular weight of 373.28 g/mol. Its IUPAC name is 4-amino-2,6-dichloro-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide.
| Compound Name | 4-amino-2,6-dichloro-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43648502 |
| Molecular Formula | C11H14Cl2N2O4S2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 4-amino-2,6-dichloro-N-(1,1-dioxothiolan-3-yl)-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O4S2/c1-15(8-2-3-20(16,17)6-8)21(18,19)11-9(12)4-7(14)5-10(11)13/h4-5,8H,2-3,6,14H2,1H3 |
| InChIKey | RUVZBKLTUNKIGB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|