C14H18O5S2 — CID 79908483
5-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfinyl)furan-2-carboxylic acid (PubChem CID 79908483) has the molecular formula C14H18O5S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfinyl)furan-2-carboxylic acid.
| Compound Name | 5-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfinyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 79908483 |
| Molecular Formula | C14H18O5S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 5-(1-oxa-9-thiaspiro[5.5]undecan-4-ylsulfinyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)C2CCOC3(CCSCC3)C2)o1 |
| InChI | InChI=1S/C14H18O5S2/c15-13(16)11-1-2-12(19-11)21(17)10-3-6-18-14(9-10)4-7-20-8-5-14/h1-2,10H,3-9H2,(H,15,16) |
| InChIKey | IGQITNOETLLNEO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |