C14H18O2S2 — CID 79912888
1-oxa-9-thiaspiro[5.5]undecan-4-yl(thiophen-2-yl)methanone (PubChem CID 79912888) has the molecular formula C14H18O2S2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-oxa-9-thiaspiro[5.5]undecan-4-yl(thiophen-2-yl)methanone.
| Compound Name | 1-oxa-9-thiaspiro[5.5]undecan-4-yl(thiophen-2-yl)methanone |
|---|---|
| PubChem CID | 79912888 |
| Molecular Formula | C14H18O2S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-oxa-9-thiaspiro[5.5]undecan-4-yl(thiophen-2-yl)methanone |
| SMILES | O=C(c1cccs1)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C14H18O2S2/c15-13(12-2-1-7-18-12)11-3-6-16-14(10-11)4-8-17-9-5-14/h1-2,7,11H,3-6,8-10H2 |
| InChIKey | PDHUOSPRWKKYJT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |