C10H15N3O2S — CID 43648521
2-N-(1,1-dioxothiolan-3-yl)-2-N-methylpyridine-2,3-diamine (PubChem CID 43648521) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 2-N-(1,1-dioxothiolan-3-yl)-2-N-methylpyridine-2,3-diamine.
| Compound Name | 2-N-(1,1-dioxothiolan-3-yl)-2-N-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 43648521 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-N-(1,1-dioxothiolan-3-yl)-2-N-methylpyridine-2,3-diamine |
| SMILES | CN(c1ncccc1N)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15N3O2S/c1-13(8-4-6-16(14,15)7-8)10-9(11)3-2-5-12-10/h2-3,5,8H,4,6-7,11H2,1H3 |
| InChIKey | GDDMYFWXYGAQSC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |