C17H26N2OS — CID 79898753
3-N-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-3-N-propylbenzene-1,3-diamine (PubChem CID 79898753) has the molecular formula C17H26N2OS and a molecular weight of 306.47 g/mol. Its IUPAC name is 3-N-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-3-N-propylbenzene-1,3-diamine.
| Compound Name | 3-N-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-3-N-propylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 79898753 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 3-N-(6-oxa-2-thiaspiro[4.5]decan-9-yl)-3-N-propylbenzene-1,3-diamine |
| SMILES | CCCN(c1cccc(N)c1)C1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C17H26N2OS/c1-2-8-19(15-5-3-4-14(18)11-15)16-6-9-20-17(12-16)7-10-21-13-17/h3-5,11,16H,2,6-10,12-13,18H2,1H3 |
| InChIKey | USGDMLNUBIWHGD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|