C20H17BrN2O2 — CID 76782575
6-(3-bromophenyl)-N-isocyanospiro[3H-chromene-2,4'-oxane]-4-imine (PubChem CID 76782575) has the molecular formula C20H17BrN2O2 and a molecular weight of 397.27 g/mol. Its IUPAC name is 6-(3-bromophenyl)-N-isocyanospiro[3H-chromene-2,4'-oxane]-4-imine.
| Compound Name | 6-(3-bromophenyl)-N-isocyanospiro[3H-chromene-2,4'-oxane]-4-imine |
|---|---|
| PubChem CID | 76782575 |
| Molecular Formula | C20H17BrN2O2 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 6-(3-bromophenyl)-N-isocyanospiro[3H-chromene-2,4'-oxane]-4-imine |
| SMILES | [C-]#[N+]N=C1CC2(CCOCC2)Oc2ccc(-c3cccc(Br)c3)cc21 |
| InChI | InChI=1S/C20H17BrN2O2/c1-22-23-18-13-20(7-9-24-10-8-20)25-19-6-5-15(12-17(18)19)14-3-2-4-16(21)11-14/h2-6,11-12H,7-10,13H2 |
| InChIKey | GKMYYGVJGYLICX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|