C27H22N4O — CID 58424642
[6-(3-cyanophenyl)-1'-phenylspiro[3H-chromene-2,4'-piperidine]-4-ylidene]cyanamide (PubChem CID 58424642) has the molecular formula C27H22N4O and a molecular weight of 418.50 g/mol. Its IUPAC name is [6-(3-cyanophenyl)-1'-phenylspiro[3H-chromene-2,4'-piperidine]-4-ylidene]cyanamide.
| Compound Name | [6-(3-cyanophenyl)-1'-phenylspiro[3H-chromene-2,4'-piperidine]-4-ylidene]cyanamide |
|---|---|
| PubChem CID | 58424642 |
| Molecular Formula | C27H22N4O |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [6-(3-cyanophenyl)-1'-phenylspiro[3H-chromene-2,4'-piperidine]-4-ylidene]cyanamide |
| SMILES | N#C/N=C1\CC2(CCN(c3ccccc3)CC2)Oc2ccc(-c3cccc(C#N)c3)cc21 |
| InChI | InChI=1S/C27H22N4O/c28-18-20-5-4-6-21(15-20)22-9-10-26-24(16-22)25(30-19-29)17-27(32-26)11-13-31(14-12-27)23-7-2-1-3-8-23/h1-10,15-16H,11-14,17H2/b30-25+ |
| InChIKey | YVXLUGAHKWJQKN-QCWLDUFUSA-N |
| XLogP | 5.32 |
| TPSA | 72.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|