C19H15N3O — CID 143944584
[6-(3-cyanophenyl)-2,2-dimethyl-3H-chromen-4-ylidene]cyanamide (PubChem CID 143944584) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is [6-(3-cyanophenyl)-2,2-dimethyl-3H-chromen-4-ylidene]cyanamide.
| Compound Name | [6-(3-cyanophenyl)-2,2-dimethyl-3H-chromen-4-ylidene]cyanamide |
|---|---|
| PubChem CID | 143944584 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [6-(3-cyanophenyl)-2,2-dimethyl-3H-chromen-4-ylidene]cyanamide |
| SMILES | CC1(C)C/C(=N\C#N)c2cc(-c3cccc(C#N)c3)ccc2O1 |
| InChI | InChI=1S/C19H15N3O/c1-19(2)10-17(22-12-21)16-9-15(6-7-18(16)23-19)14-5-3-4-13(8-14)11-20/h3-9H,10H2,1-2H3/b22-17+ |
| InChIKey | HGVPWHLTYVNOFU-OQKWZONESA-N |
| XLogP | 4.06 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|