C16H12N2O — CID 86611492
3-[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]benzonitrile (PubChem CID 86611492) has the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]benzonitrile.
| Compound Name | 3-[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]benzonitrile |
|---|---|
| PubChem CID | 86611492 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3c(c2)CC/C3=N/O)c1 |
| InChI | InChI=1S/C16H12N2O/c17-10-11-2-1-3-12(8-11)13-4-6-15-14(9-13)5-7-16(15)18-19/h1-4,6,8-9,19H,5,7H2/b18-16- |
| InChIKey | IJFFHANIFLPFPQ-VLGSPTGOSA-N |
| XLogP | 3.35 |
| TPSA | 56.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|