C14H14ClNO — CID 11064748
(2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-cyclopropylacetamide (PubChem CID 11064748) has the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. Its IUPAC name is (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-cyclopropylacetamide.
| Compound Name | (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 11064748 |
| Molecular Formula | C14H14ClNO |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (2E)-2-(5-chloro-2,3-dihydroinden-1-ylidene)-N-cyclopropylacetamide |
| SMILES | O=C(/C=C1\CCc2cc(Cl)ccc21)NC1CC1 |
| InChI | InChI=1S/C14H14ClNO/c15-11-3-6-13-9(7-11)1-2-10(13)8-14(17)16-12-4-5-12/h3,6-8,12H,1-2,4-5H2,(H,16,17)/b10-8+ |
| InChIKey | BGHMWJAZNCTSRV-CSKARUKUSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|