C11H7Cl2FO — CID 11107593
(2E)-2-(4-chloro-6-fluoro-2,3-dihydroinden-1-ylidene)acetyl chloride (PubChem CID 11107593) has the molecular formula C11H7Cl2FO and a molecular weight of 245.08 g/mol. Its IUPAC name is (2E)-2-(4-chloro-6-fluoro-2,3-dihydroinden-1-ylidene)acetyl chloride.
| Compound Name | (2E)-2-(4-chloro-6-fluoro-2,3-dihydroinden-1-ylidene)acetyl chloride |
|---|---|
| PubChem CID | 11107593 |
| Molecular Formula | C11H7Cl2FO |
| Molecular Weight | 245.08 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | (2E)-2-(4-chloro-6-fluoro-2,3-dihydroinden-1-ylidene)acetyl chloride |
| SMILES | O=C(Cl)/C=C1\CCc2c(Cl)cc(F)cc21 |
| InChI | InChI=1S/C11H7Cl2FO/c12-10-5-7(14)4-9-6(3-11(13)15)1-2-8(9)10/h3-5H,1-2H2/b6-3+ |
| InChIKey | HOGIORNCBHTVJG-ZZXKWVIFSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.08 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|