C13H12ClFO — CID 57269691
2-(6-fluoro-3,3-dimethyl-2H-inden-1-ylidene)acetyl chloride (PubChem CID 57269691) has the molecular formula C13H12ClFO and a molecular weight of 238.69 g/mol. Its IUPAC name is 2-(6-fluoro-3,3-dimethyl-2H-inden-1-ylidene)acetyl chloride.
| Compound Name | 2-(6-fluoro-3,3-dimethyl-2H-inden-1-ylidene)acetyl chloride |
|---|---|
| PubChem CID | 57269691 |
| Molecular Formula | C13H12ClFO |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 2-(6-fluoro-3,3-dimethyl-2H-inden-1-ylidene)acetyl chloride |
| SMILES | CC1(C)CC(=CC(=O)Cl)c2cc(F)ccc21 |
| InChI | InChI=1S/C13H12ClFO/c1-13(2)7-8(5-12(14)16)10-6-9(15)3-4-11(10)13/h3-6H,7H2,1-2H3 |
| InChIKey | ZYOPWXIOFBNDTO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|